About hexyl adamantane-1-carboxylate
hexyl adamantane-1-carboxylate (PubChem CID 585438) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is hexyl adamantane-1-carboxylate.
Molecular Properties
| Compound Name | hexyl adamantane-1-carboxylate |
| PubChem CID | 585438 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | hexyl adamantane-1-carboxylate |
| SMILES | CCCCCCOC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H28O2/c1-2-3-4-5-6-19-16(18)17-10-13-7-14(11-17)9-15(8-13)12-17/h13-15H,2-12H2,1H3 |
| InChIKey | FNTBYCDLLBOPTG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl adamantane-1-carboxylate?
The IUPAC name of hexyl adamantane-1-carboxylate (CID 585438) is hexyl adamantane-1-carboxylate.
What is the SMILES notation for hexyl adamantane-1-carboxylate?
The canonical SMILES for hexyl adamantane-1-carboxylate is CCCCCCOC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of hexyl adamantane-1-carboxylate?
The InChIKey is FNTBYCDLLBOPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-2-3-4-5-6-19-16(18)17-10-13-7-14(11-17)9-15(8-13)12-17/h13-15H,2-12H2,1H3.
What are the key properties of hexyl adamantane-1-carboxylate?
hexyl adamantane-1-carboxylate has a molecular weight of 264.41 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl adamantane-1-carboxylate is sourced from PubChem (CID 585438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).