About 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone
1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone (PubChem CID 58543996) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone |
| PubChem CID | 58543996 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone |
| SMILES | CC(=O)[C@H]1CCC[C@H](N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C13H24N2O/c1-11(16)12-4-3-5-13(10-12)15-8-6-14(2)7-9-15/h12-13H,3-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | RPMNOXDSBOVCTE-STQMWFEESA-N |
| XLogP | 1.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone?
The IUPAC name of 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone (CID 58543996) is 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone.
What is the SMILES notation for 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone?
The canonical SMILES for 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone is CC(=O)[C@H]1CCC[C@H](N2CCN(C)CC2)C1.
What is the InChIKey of 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone?
The InChIKey is RPMNOXDSBOVCTE-STQMWFEESA-N. The full InChI is InChI=1S/C13H24N2O/c1-11(16)12-4-3-5-13(10-12)15-8-6-14(2)7-9-15/h12-13H,3-10H2,1-2H3/t12-,13-/m0/s1.
What are the key properties of 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone?
1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone has a molecular weight of 224.35 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,3S)-3-(4-methylpiperazin-1-yl)cyclohexyl]ethanone is sourced from PubChem (CID 58543996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).