C12H23N3 — CID 58544017
(1R,5R)-N-methyl-5-(4-methylpiperazin-1-yl)cyclohex-3-en-1-amine (PubChem CID 58544017) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (1R,5R)-N-methyl-5-(4-methylpiperazin-1-yl)cyclohex-3-en-1-amine.
| Compound Name | (1R,5R)-N-methyl-5-(4-methylpiperazin-1-yl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 58544017 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (1R,5R)-N-methyl-5-(4-methylpiperazin-1-yl)cyclohex-3-en-1-amine |
| SMILES | CN[C@@H]1CC=C[C@H](N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C12H23N3/c1-13-11-4-3-5-12(10-11)15-8-6-14(2)7-9-15/h3,5,11-13H,4,6-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | BEUHQLXSOAINHI-NEPJUHHUSA-N |
| XLogP | 0.54 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|