About 3-methyliminobutyl propanoate
3-methyliminobutyl propanoate (PubChem CID 58544166) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-methyliminobutyl propanoate.
Molecular Properties
| Compound Name | 3-methyliminobutyl propanoate |
| PubChem CID | 58544166 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-methyliminobutyl propanoate |
| SMILES | CCC(=O)OCC/C(C)=N/C |
| InChI | InChI=1S/C8H15NO2/c1-4-8(10)11-6-5-7(2)9-3/h4-6H2,1-3H3/b9-7+ |
| InChIKey | MPYNSRQHXRNBFO-VQHVLOKHSA-N |
| XLogP | 1.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyliminobutyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyliminobutyl propanoate?
The IUPAC name of 3-methyliminobutyl propanoate (CID 58544166) is 3-methyliminobutyl propanoate.
What is the SMILES notation for 3-methyliminobutyl propanoate?
The canonical SMILES for 3-methyliminobutyl propanoate is CCC(=O)OCC/C(C)=N/C.
What is the InChIKey of 3-methyliminobutyl propanoate?
The InChIKey is MPYNSRQHXRNBFO-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15NO2/c1-4-8(10)11-6-5-7(2)9-3/h4-6H2,1-3H3/b9-7+.
What are the key properties of 3-methyliminobutyl propanoate?
3-methyliminobutyl propanoate has a molecular weight of 157.21 g/mol, XLogP of 1.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyliminobutyl propanoate is sourced from PubChem (CID 58544166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).