About 3,3,3-trifluoropropyl phosphate
3,3,3-trifluoropropyl phosphate (PubChem CID 58544431) has the molecular formula C3H4F3O4P-2
and a molecular weight of 192.03 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl phosphate.
Molecular Properties
| Compound Name | 3,3,3-trifluoropropyl phosphate |
| PubChem CID | 58544431 |
| Molecular Formula | C3H4F3O4P-2 |
| Molecular Weight | 192.03 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 3,3,3-trifluoropropyl phosphate |
| SMILES | O=P([O-])([O-])OCCC(F)(F)F |
| InChI | InChI=1S/C3H6F3O4P/c4-3(5,6)1-2-10-11(7,8)9/h1-2H2,(H2,7,8,9)/p-2 |
| InChIKey | JRFGITQZJDGRPA-UHFFFAOYSA-L |
| XLogP | -0.22 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.03 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,3,3-trifluoropropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropyl phosphate?
The IUPAC name of 3,3,3-trifluoropropyl phosphate (CID 58544431) is 3,3,3-trifluoropropyl phosphate.
What is the SMILES notation for 3,3,3-trifluoropropyl phosphate?
The canonical SMILES for 3,3,3-trifluoropropyl phosphate is O=P([O-])([O-])OCCC(F)(F)F.
What is the InChIKey of 3,3,3-trifluoropropyl phosphate?
The InChIKey is JRFGITQZJDGRPA-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6F3O4P/c4-3(5,6)1-2-10-11(7,8)9/h1-2H2,(H2,7,8,9)/p-2.
What are the key properties of 3,3,3-trifluoropropyl phosphate?
3,3,3-trifluoropropyl phosphate has a molecular weight of 192.03 g/mol, XLogP of -0.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropyl phosphate is sourced from PubChem (CID 58544431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).