C32H28O2 — CID 58544515
4-[10-(4-formylphenyl)-2,7,9,10-tetramethylphenanthren-9-yl]benzaldehyde (PubChem CID 58544515) has the molecular formula C32H28O2 and a molecular weight of 444.57 g/mol. Its IUPAC name is 4-[10-(4-formylphenyl)-2,7,9,10-tetramethylphenanthren-9-yl]benzaldehyde.
| Compound Name | 4-[10-(4-formylphenyl)-2,7,9,10-tetramethylphenanthren-9-yl]benzaldehyde |
|---|---|
| PubChem CID | 58544515 |
| Molecular Formula | C32H28O2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[10-(4-formylphenyl)-2,7,9,10-tetramethylphenanthren-9-yl]benzaldehyde |
| SMILES | Cc1ccc2c(c1)C(C)(c1ccc(C=O)cc1)C(C)(c1ccc(C=O)cc1)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C32H28O2/c1-21-5-15-27-28-16-6-22(2)18-30(28)32(4,26-13-9-24(20-34)10-14-26)31(3,29(27)17-21)25-11-7-23(19-33)8-12-25/h5-20H,1-4H3 |
| InChIKey | UZYADBMUTBCRMF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|