C12H22O — CID 58545189
(3E,7Z)-2,6,6-trimethylnona-3,7-dien-2-ol (PubChem CID 58545189) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (3E,7Z)-2,6,6-trimethylnona-3,7-dien-2-ol.
| Compound Name | (3E,7Z)-2,6,6-trimethylnona-3,7-dien-2-ol |
|---|---|
| PubChem CID | 58545189 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (3E,7Z)-2,6,6-trimethylnona-3,7-dien-2-ol |
| SMILES | C/C=C\C(C)(C)C/C=C/C(C)(C)O |
| InChI | InChI=1S/C12H22O/c1-6-8-11(2,3)9-7-10-12(4,5)13/h6-8,10,13H,9H2,1-5H3/b8-6-,10-7+ |
| InChIKey | RHFUJUPNBLKBNG-GOOBONSCSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|