C12H24O2 — CID 58545194
(Z)-2,6,6-trimethylnon-7-ene-2,3-diol (PubChem CID 58545194) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-2,6,6-trimethylnon-7-ene-2,3-diol.
| Compound Name | (Z)-2,6,6-trimethylnon-7-ene-2,3-diol |
|---|---|
| PubChem CID | 58545194 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-2,6,6-trimethylnon-7-ene-2,3-diol |
| SMILES | C/C=C\C(C)(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C12H24O2/c1-6-8-11(2,3)9-7-10(13)12(4,5)14/h6,8,10,13-14H,7,9H2,1-5H3/b8-6- |
| InChIKey | ZEHVVQKNGFKRJU-VURMDHGXSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|