C17H27NO5 — CID 58545251
2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propoxy]ethyl 2,2-dimethylbutanoate (PubChem CID 58545251) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propoxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propoxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58545251 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propoxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C17H27NO5/c1-6-17(4,5)16(21)23-11-10-22-9-7-8-18-14(19)12(2)13(3)15(18)20/h6-11H2,1-5H3 |
| InChIKey | GNIJSMLDWCJDKU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|