C7H5F9O — CID 58545265
2-(1,1-difluoroethyl)-2,3,3,5,5,6,6-heptafluorooxane (PubChem CID 58545265) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,3,5,5,6,6-heptafluorooxane.
| Compound Name | 2-(1,1-difluoroethyl)-2,3,3,5,5,6,6-heptafluorooxane |
|---|---|
| PubChem CID | 58545265 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2,3,3,5,5,6,6-heptafluorooxane |
| SMILES | CC(F)(F)C1(F)OC(F)(F)C(F)(F)CC1(F)F |
| InChI | InChI=1S/C7H5F9O/c1-3(8,9)6(14)4(10,11)2-5(12,13)7(15,16)17-6/h2H2,1H3 |
| InChIKey | OMBXVXDZULFABB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|