C7H5F9O2 — CID 58545276
2-(1,1-difluoroethyl)-2,3,5,5,6,6-hexafluoro-3-(fluoromethyl)-1,4-dioxane (PubChem CID 58545276) has the molecular formula C7H5F9O2 and a molecular weight of 292.10 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,5,5,6,6-hexafluoro-3-(fluoromethyl)-1,4-dioxane.
| Compound Name | 2-(1,1-difluoroethyl)-2,3,5,5,6,6-hexafluoro-3-(fluoromethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 58545276 |
| Molecular Formula | C7H5F9O2 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2,3,5,5,6,6-hexafluoro-3-(fluoromethyl)-1,4-dioxane |
| SMILES | CC(F)(F)C1(F)OC(F)(F)C(F)(F)OC1(F)CF |
| InChI | InChI=1S/C7H5F9O2/c1-3(9,10)5(12)4(11,2-8)17-6(13,14)7(15,16)18-5/h2H2,1H3 |
| InChIKey | QUZZHXSSHHZNBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|