C8H5F11O — CID 58545280
2-(1,1-difluoroethyl)-2,3,3,5,5,6-hexafluoro-6-(trifluoromethyl)oxane (PubChem CID 58545280) has the molecular formula C8H5F11O and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,3,5,5,6-hexafluoro-6-(trifluoromethyl)oxane.
| Compound Name | 2-(1,1-difluoroethyl)-2,3,3,5,5,6-hexafluoro-6-(trifluoromethyl)oxane |
|---|---|
| PubChem CID | 58545280 |
| Molecular Formula | C8H5F11O |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2,3,3,5,5,6-hexafluoro-6-(trifluoromethyl)oxane |
| SMILES | CC(F)(F)C1(F)OC(F)(C(F)(F)F)C(F)(F)CC1(F)F |
| InChI | InChI=1S/C8H5F11O/c1-3(9,10)6(15)4(11,12)2-5(13,14)7(16,20-6)8(17,18)19/h2H2,1H3 |
| InChIKey | KHZLRMUQJODZOO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |