C22H30N4O3 — CID 58546998
tert-butyl 3-[3-[4-(hydroxymethyl)piperidin-1-yl]quinoxalin-2-yl]azetidine-1-carboxylate (PubChem CID 58546998) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is tert-butyl 3-[3-[4-(hydroxymethyl)piperidin-1-yl]quinoxalin-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[4-(hydroxymethyl)piperidin-1-yl]quinoxalin-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 58546998 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | tert-butyl 3-[3-[4-(hydroxymethyl)piperidin-1-yl]quinoxalin-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2nc3ccccc3nc2N2CCC(CO)CC2)C1 |
| InChI | InChI=1S/C22H30N4O3/c1-22(2,3)29-21(28)26-12-16(13-26)19-20(25-10-8-15(14-27)9-11-25)24-18-7-5-4-6-17(18)23-19/h4-7,15-16,27H,8-14H2,1-3H3 |
| InChIKey | XOLFKBJBIVTXNH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |