About 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine
3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine (PubChem CID 58547042) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine.
Molecular Properties
| Compound Name | 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine |
| PubChem CID | 58547042 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine |
| SMILES | C/C=C\C(=C(C)C)C1CNC1 |
| InChI | InChI=1S/C10H17N/c1-4-5-10(8(2)3)9-6-11-7-9/h4-5,9,11H,6-7H2,1-3H3/b5-4- |
| InChIKey | XXUGIKQUXYVTDL-PLNGDYQASA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine?
The IUPAC name of 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine (CID 58547042) is 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine.
What is the SMILES notation for 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine?
The canonical SMILES for 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine is C/C=C\C(=C(C)C)C1CNC1.
What is the InChIKey of 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine?
The InChIKey is XXUGIKQUXYVTDL-PLNGDYQASA-N. The full InChI is InChI=1S/C10H17N/c1-4-5-10(8(2)3)9-6-11-7-9/h4-5,9,11H,6-7H2,1-3H3/b5-4-.
What are the key properties of 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine?
3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine has a molecular weight of 151.25 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4Z)-2-methylhexa-2,4-dien-3-yl]azetidine is sourced from PubChem (CID 58547042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).