C27H32N6O2 — CID 58547072
tert-butyl (3aS,6aR)-2-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 58547072) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-2-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-2-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58547072 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | tert-butyl (3aS,6aR)-2-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(c3nccnc3C3CN(c4ccc5ccccc5n4)C3)C[C@@H]2C1 |
| InChI | InChI=1S/C27H32N6O2/c1-27(2,3)35-26(34)33-14-19-12-32(13-20(19)15-33)25-24(28-10-11-29-25)21-16-31(17-21)23-9-8-18-6-4-5-7-22(18)30-23/h4-11,19-21H,12-17H2,1-3H3/t19-,20+ |
| InChIKey | JXRJMQILVQDVKJ-BGYRXZFFSA-N |
| XLogP | 3.93 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |