C10H12N2Y-2 — CID 58547316
2H-imidazo[1,2-a]pyridin-2-ide;propane;yttrium (PubChem CID 58547316) has the molecular formula C10H12N2Y-2 and a molecular weight of 249.13 g/mol. Its IUPAC name is 2H-imidazo[1,2-a]pyridin-2-ide;propane;yttrium.
| Compound Name | 2H-imidazo[1,2-a]pyridin-2-ide;propane;yttrium |
|---|---|
| PubChem CID | 58547316 |
| Molecular Formula | C10H12N2Y-2 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2H-imidazo[1,2-a]pyridin-2-ide;propane;yttrium |
| SMILES | C[CH-]C.[Y].[c-]1cn2ccccc2n1 |
| InChI | InChI=1S/C7H5N2.C3H7.Y/c1-2-5-9-6-4-8-7(9)3-1;1-3-2;/h1-3,5-6H;3H,1-2H3;/q2*-1; |
| InChIKey | PICMAZIEDYGACE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|