About propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium
propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium (PubChem CID 58547547) has the molecular formula C12H11N3Y-2
and a molecular weight of 286.15 g/mol. Its IUPAC name is propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium.
Molecular Properties
| Compound Name | propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium |
| PubChem CID | 58547547 |
| Molecular Formula | C12H11N3Y-2 |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium |
| SMILES | C[CH-]C.N#Cc1ccc2nc[c-]nc2c1.[Y] |
| InChI | InChI=1S/C9H4N3.C3H7.Y/c10-6-7-1-2-8-9(5-7)12-4-3-11-8;1-3-2;/h1-3,5H;3H,1-2H3;/q2*-1; |
| InChIKey | YQKSAOPAHWNAOT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium?
The IUPAC name of propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium (CID 58547547) is propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium.
What is the SMILES notation for propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium?
The canonical SMILES for propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium is C[CH-]C.N#Cc1ccc2nc[c-]nc2c1.[Y].
What is the InChIKey of propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium?
The InChIKey is YQKSAOPAHWNAOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N3.C3H7.Y/c10-6-7-1-2-8-9(5-7)12-4-3-11-8;1-3-2;/h1-3,5H;3H,1-2H3;/q2*-1;.
What are the key properties of propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium?
propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium has a molecular weight of 286.15 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;3H-quinoxalin-3-ide-6-carbonitrile;yttrium is sourced from PubChem (CID 58547547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).