About 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile
1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile (PubChem CID 58547580) has the molecular formula C21H21N7
and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile |
| PubChem CID | 58547580 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(c2nccnc2C2CN(c3ccc4cnccc4n3)C2)CC1 |
| InChI | InChI=1S/C21H21N7/c22-11-15-4-9-27(10-5-15)21-20(24-7-8-25-21)17-13-28(14-17)19-2-1-16-12-23-6-3-18(16)26-19/h1-3,6-8,12,15,17H,4-5,9-10,13-14H2 |
| InChIKey | DWRLGKJIMKFREJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile?
The IUPAC name of 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile (CID 58547580) is 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile.
What is the SMILES notation for 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile?
The canonical SMILES for 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile is N#CC1CCN(c2nccnc2C2CN(c3ccc4cnccc4n3)C2)CC1.
What is the InChIKey of 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile?
The InChIKey is DWRLGKJIMKFREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7/c22-11-15-4-9-27(10-5-15)21-20(24-7-8-25-21)17-13-28(14-17)19-2-1-16-12-23-6-3-18(16)26-19/h1-3,6-8,12,15,17H,4-5,9-10,13-14H2.
What are the key properties of 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile?
1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile has a molecular weight of 371.45 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[1-(1,6-naphthyridin-2-yl)azetidin-3-yl]pyrazin-2-yl]piperidine-4-carbonitrile is sourced from PubChem (CID 58547580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).