C16H25NOY-2 — CID 58548645
3-[(2Z,4E)-4-ethyl-3-[(Z)-prop-1-enyl]hexa-2,4-dien-2-yl]oxy-N-methylcyclobutan-1-amine;yttrium (PubChem CID 58548645) has the molecular formula C16H25NOY-2 and a molecular weight of 336.29 g/mol. Its IUPAC name is 3-[(2Z,4E)-4-ethyl-3-[(Z)-prop-1-enyl]hexa-2,4-dien-2-yl]oxy-N-methylcyclobutan-1-amine;yttrium.
| Compound Name | 3-[(2Z,4E)-4-ethyl-3-[(Z)-prop-1-enyl]hexa-2,4-dien-2-yl]oxy-N-methylcyclobutan-1-amine;yttrium |
|---|---|
| PubChem CID | 58548645 |
| Molecular Formula | C16H25NOY-2 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-[(2Z,4E)-4-ethyl-3-[(Z)-prop-1-enyl]hexa-2,4-dien-2-yl]oxy-N-methylcyclobutan-1-amine;yttrium |
| SMILES | [CH2-]/C=C(C[CH2-])/C(/C=C\C)=C(/C)OC1CC(NC)C1.[Y] |
| InChI | InChI=1S/C16H25NO.Y/c1-6-9-16(13(7-2)8-3)12(4)18-15-10-14(11-15)17-5;/h6-7,9,14-15,17H,2-3,8,10-11H2,1,4-5H3;/q-2;/b9-6-,13-7+,16-12-; |
| InChIKey | FQPIDYSZDPPUGI-GRGYQFRFSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|