About 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine
3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine (PubChem CID 58548658) has the molecular formula C10H9F2NO
and a molecular weight of 197.18 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine.
Molecular Properties
| Compound Name | 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine |
| PubChem CID | 58548658 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine |
| SMILES | Fc1cnc(F)c(C2=CCOCC2)c1 |
| InChI | InChI=1S/C10H9F2NO/c11-8-5-9(10(12)13-6-8)7-1-3-14-4-2-7/h1,5-6H,2-4H2 |
| InChIKey | BGFBAGSWIYINFE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine?
The IUPAC name of 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine (CID 58548658) is 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine.
What is the SMILES notation for 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine?
The canonical SMILES for 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine is Fc1cnc(F)c(C2=CCOCC2)c1.
What is the InChIKey of 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine?
The InChIKey is BGFBAGSWIYINFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO/c11-8-5-9(10(12)13-6-8)7-1-3-14-4-2-7/h1,5-6H,2-4H2.
What are the key properties of 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine?
3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine has a molecular weight of 197.18 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dihydro-2H-pyran-4-yl)-2,5-difluoropyridine is sourced from PubChem (CID 58548658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).