About tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate
tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate (PubChem CID 58548662) has the molecular formula C19H25FN2O4
and a molecular weight of 364.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate |
| PubChem CID | 58548662 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Oc2ncc(F)cc2C2=CCOCC2)C1 |
| InChI | InChI=1S/C19H25FN2O4/c1-19(2,3)26-18(23)22-14-9-15(10-14)25-17-16(8-13(20)11-21-17)12-4-6-24-7-5-12/h4,8,11,14-15H,5-7,9-10H2,1-3H3,(H,22,23) |
| InChIKey | HWCDNPYMPLRGDE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate?
The IUPAC name of tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate (CID 58548662) is tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate.
What is the SMILES notation for tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate?
The canonical SMILES for tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate is CC(C)(C)OC(=O)NC1CC(Oc2ncc(F)cc2C2=CCOCC2)C1.
What is the InChIKey of tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate?
The InChIKey is HWCDNPYMPLRGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FN2O4/c1-19(2,3)26-18(23)22-14-9-15(10-14)25-17-16(8-13(20)11-21-17)12-4-6-24-7-5-12/h4,8,11,14-15H,5-7,9-10H2,1-3H3,(H,22,23).
What are the key properties of tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate?
tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate has a molecular weight of 364.42 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamate is sourced from PubChem (CID 58548662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).