C32H37N3O — CID 58549040
[(2R,4S)-2,4-diphenylpiperidin-1-yl]-[(3'S,5R)-2-ethylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 58549040) has the molecular formula C32H37N3O and a molecular weight of 479.67 g/mol. Its IUPAC name is [(2R,4S)-2,4-diphenylpiperidin-1-yl]-[(3'S,5R)-2-ethylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2R,4S)-2,4-diphenylpiperidin-1-yl]-[(3'S,5R)-2-ethylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549040 |
| Molecular Formula | C32H37N3O |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | [(2R,4S)-2,4-diphenylpiperidin-1-yl]-[(3'S,5R)-2-ethylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | CCc1ccc2c(n1)CCC[C@]21CNC[C@H]1C(=O)N1CC[C@H](c2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H37N3O/c1-2-26-15-16-27-29(34-26)14-9-18-32(27)22-33-21-28(32)31(36)35-19-17-25(23-10-5-3-6-11-23)20-30(35)24-12-7-4-8-13-24/h3-8,10-13,15-16,25,28,30,33H,2,9,14,17-22H2,1H3/t25-,28-,30+,32-/m0/s1 |
| InChIKey | QMMNYKHUIHNYLY-VSMXWHNRSA-N |
| XLogP | 5.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |