C27H32F3N2O3+ — CID 58549447
[(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone (PubChem CID 58549447) has the molecular formula C27H32F3N2O3+ and a molecular weight of 489.56 g/mol. Its IUPAC name is [(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone.
| Compound Name | [(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58549447 |
| Molecular Formula | C27H32F3N2O3+ |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
| SMILES | COc1cccc2c1OCC[C@]21C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1CC(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O3/c1-34-23-9-5-8-21-24(23)35-13-11-26(21)17-31-16-22(26)25(33)32-12-10-19(18-6-3-2-4-7-18)14-20(32)15-27(28,29)30/h2-9,19-20,22,31H,10-17H2,1H3/p+1/t19-,20+,22+,26+/m1/s1 |
| InChIKey | FWUBRJKWQUTRQF-URNZLVBDSA-O |
| XLogP | 3.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |