C20H28N2O4 — CID 58549796
(2R,5S)-5-hydroxy-2,6-dimethyl-4-oxo-N-[(1S)-4,4,5,5-tetradeuterio-3-methyl-2-oxo-1H-3-benzazepin-1-yl]heptanamide (PubChem CID 58549796) has the molecular formula C20H28N2O4 and a molecular weight of 364.48 g/mol. Its IUPAC name is (2R,5S)-5-hydroxy-2,6-dimethyl-4-oxo-N-[(1S)-4,4,5,5-tetradeuterio-3-methyl-2-oxo-1H-3-benzazepin-1-yl]heptanamide.
| Compound Name | (2R,5S)-5-hydroxy-2,6-dimethyl-4-oxo-N-[(1S)-4,4,5,5-tetradeuterio-3-methyl-2-oxo-1H-3-benzazepin-1-yl]heptanamide |
|---|---|
| PubChem CID | 58549796 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (2R,5S)-5-hydroxy-2,6-dimethyl-4-oxo-N-[(1S)-4,4,5,5-tetradeuterio-3-methyl-2-oxo-1H-3-benzazepin-1-yl]heptanamide |
| SMILES | [2H]C1([2H])c2ccccc2[C@H](NC(=O)[C@H](C)CC(=O)[C@@H](O)C(C)C)C(=O)N(C)C1([2H])[2H] |
| InChI | InChI=1S/C20H28N2O4/c1-12(2)18(24)16(23)11-13(3)19(25)21-17-15-8-6-5-7-14(15)9-10-22(4)20(17)26/h5-8,12-13,17-18,24H,9-11H2,1-4H3,(H,21,25)/t13-,17+,18+/m1/s1/i9D2,10D2 |
| InChIKey | JAYBDOWPSTWZHR-LGWMNFFFSA-N |
| XLogP | 1.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |