C21H30N2O4 — CID 58549840
(2R,5S)-2,5-dideuterio-N-[(5S)-2-deuterio-2,3-dimethyl-4-oxo-1,5-dihydro-3-benzazepin-5-yl]-5-hydroxy-2,6-dimethyl-4-oxoheptanamide (PubChem CID 58549840) has the molecular formula C21H30N2O4 and a molecular weight of 377.50 g/mol. Its IUPAC name is (2R,5S)-2,5-dideuterio-N-[(5S)-2-deuterio-2,3-dimethyl-4-oxo-1,5-dihydro-3-benzazepin-5-yl]-5-hydroxy-2,6-dimethyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-2,5-dideuterio-N-[(5S)-2-deuterio-2,3-dimethyl-4-oxo-1,5-dihydro-3-benzazepin-5-yl]-5-hydroxy-2,6-dimethyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 58549840 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (2R,5S)-2,5-dideuterio-N-[(5S)-2-deuterio-2,3-dimethyl-4-oxo-1,5-dihydro-3-benzazepin-5-yl]-5-hydroxy-2,6-dimethyl-4-oxoheptanamide |
| SMILES | [2H]C1(C)Cc2ccccc2[C@H](NC(=O)[C@]([2H])(C)CC(=O)[C@@]([2H])(O)C(C)C)C(=O)N1C |
| InChI | InChI=1S/C21H30N2O4/c1-12(2)19(25)17(24)10-13(3)20(26)22-18-16-9-7-6-8-15(16)11-14(4)23(5)21(18)27/h6-9,12-14,18-19,25H,10-11H2,1-5H3,(H,22,26)/t13-,14?,18+,19+/m1/s1/i13D,14D,19D |
| InChIKey | GOGWPEVKLOMZBX-RXRPTSHMSA-N |
| XLogP | 1.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |