C35H32F2N4O2 — CID 58550638
(3S)-3'-[[(9R)-9-(3,5-difluorophenyl)-11-oxo-6-azaspiro[4.6]undecan-10-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one (PubChem CID 58550638) has the molecular formula C35H32F2N4O2 and a molecular weight of 578.66 g/mol. Its IUPAC name is (3S)-3'-[[(9R)-9-(3,5-difluorophenyl)-11-oxo-6-azaspiro[4.6]undecan-10-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one.
| Compound Name | (3S)-3'-[[(9R)-9-(3,5-difluorophenyl)-11-oxo-6-azaspiro[4.6]undecan-10-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one |
|---|---|
| PubChem CID | 58550638 |
| Molecular Formula | C35H32F2N4O2 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (3S)-3'-[[(9R)-9-(3,5-difluorophenyl)-11-oxo-6-azaspiro[4.6]undecan-10-yl]methyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2-one |
| SMILES | O=C1C(Cc2cnc3cc4c(cc3c2)C[C@@]2(C4)C(=O)Nc3ncccc32)[C@H](c2cc(F)cc(F)c2)CCNC12CCCC2 |
| InChI | InChI=1S/C35H32F2N4O2/c36-25-13-21(14-26(37)16-25)27-5-9-40-35(6-1-2-7-35)31(42)28(27)11-20-10-22-12-23-17-34(18-24(23)15-30(22)39-19-20)29-4-3-8-38-32(29)41-33(34)43/h3-4,8,10,12-16,19,27-28,40H,1-2,5-7,9,11,17-18H2,(H,38,41,43)/t27-,28?,34-/m0/s1 |
| InChIKey | IPTNUMAWYJXRQD-RZQUFGJYSA-N |
| XLogP | 5.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |