C25H21Cl2F3N2O4 — CID 58551091
(7'-chlorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)-[2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxyphenyl]methanone (PubChem CID 58551091) has the molecular formula C25H21Cl2F3N2O4 and a molecular weight of 541.35 g/mol. Its IUPAC name is (7'-chlorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)-[2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxyphenyl]methanone.
| Compound Name | (7'-chlorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)-[2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 58551091 |
| Molecular Formula | C25H21Cl2F3N2O4 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | (7'-chlorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)-[2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxyphenyl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC3(CC2)Oc2cc(Cl)ccc2-n2cccc23)c(OC(F)(F)C(F)Cl)c1 |
| InChI | InChI=1S/C25H21Cl2F3N2O4/c1-34-16-5-6-17(19(14-16)36-25(29,30)23(27)28)22(33)31-11-8-24(9-12-31)21-3-2-10-32(21)18-7-4-15(26)13-20(18)35-24/h2-7,10,13-14,23H,8-9,11-12H2,1H3 |
| InChIKey | FIFWBZYTYLOUHQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|