C26H24N4O3 — CID 58551202
1-(1-methylindol-3-yl)-2-(1-methylspiro[chromeno[3,4-d]pyrazole-4,4'-piperidine]-1'-yl)ethane-1,2-dione (PubChem CID 58551202) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-(1-methylindol-3-yl)-2-(1-methylspiro[chromeno[3,4-d]pyrazole-4,4'-piperidine]-1'-yl)ethane-1,2-dione.
| Compound Name | 1-(1-methylindol-3-yl)-2-(1-methylspiro[chromeno[3,4-d]pyrazole-4,4'-piperidine]-1'-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 58551202 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-(1-methylindol-3-yl)-2-(1-methylspiro[chromeno[3,4-d]pyrazole-4,4'-piperidine]-1'-yl)ethane-1,2-dione |
| SMILES | Cn1ncc2c1-c1ccccc1OC21CCN(C(=O)C(=O)c2cn(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H24N4O3/c1-28-16-19(17-7-3-5-9-21(17)28)24(31)25(32)30-13-11-26(12-14-30)20-15-27-29(2)23(20)18-8-4-6-10-22(18)33-26/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | YHYOOZHWVOWSBG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|