C29H31FN2O6 — CID 58551323
[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-methoxyphenyl]-(7'-fluorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)methanone (PubChem CID 58551323) has the molecular formula C29H31FN2O6 and a molecular weight of 522.57 g/mol. Its IUPAC name is [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-methoxyphenyl]-(7'-fluorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)methanone.
| Compound Name | [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-methoxyphenyl]-(7'-fluorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)methanone |
|---|---|
| PubChem CID | 58551323 |
| Molecular Formula | C29H31FN2O6 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-methoxyphenyl]-(7'-fluorospiro[piperidine-4,4'-pyrrolo[2,1-c][1,4]benzoxazine]-1-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)Oc2cc(F)ccc2-n2cccc23)ccc1OC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C29H31FN2O6/c1-28(2)36-18-21(37-28)17-35-23-9-6-19(15-25(23)34-3)27(33)31-13-10-29(11-14-31)26-5-4-12-32(26)22-8-7-20(30)16-24(22)38-29/h4-9,12,15-16,21H,10-11,13-14,17-18H2,1-3H3/t21-/m1/s1 |
| InChIKey | QXOMGYGMELBCAP-OAQYLSRUSA-N |
| XLogP | 4.68 |
| TPSA | 71.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |