C16H20BN3O2 — CID 58551328
methyl-(3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-yl)borinic acid (PubChem CID 58551328) has the molecular formula C16H20BN3O2 and a molecular weight of 297.17 g/mol. Its IUPAC name is methyl-(3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-yl)borinic acid.
| Compound Name | methyl-(3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-yl)borinic acid |
|---|---|
| PubChem CID | 58551328 |
| Molecular Formula | C16H20BN3O2 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl-(3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-yl)borinic acid |
| SMILES | CB(O)N1CCC2(CC1)Oc1ncccc1-n1c(C)ccc12 |
| InChI | InChI=1S/C16H20BN3O2/c1-12-5-6-14-16(7-10-19(11-8-16)17(2)21)22-15-13(20(12)14)4-3-9-18-15/h3-6,9,21H,7-8,10-11H2,1-2H3 |
| InChIKey | HFIJUKOQCCEFJF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|