C20H25N3O3 — CID 58551449
tert-butyl 3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate (PubChem CID 58551449) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl 3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 58551449 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl 3-methylspiro[8-oxa-2,10-diazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate |
| SMILES | Cc1ccc2n1-c1cccnc1OC21CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-7-8-16-20(25-17-15(23(14)16)6-5-11-21-17)9-12-22(13-10-20)18(24)26-19(2,3)4/h5-8,11H,9-10,12-13H2,1-4H3 |
| InChIKey | KOMNBWWAMMNJGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |