C29H56 — CID 58552549
5-[4-(3,5-ditert-butyl-4-methylcyclohexyl)butyl]-1,1,3,3-tetramethylcyclohexane (PubChem CID 58552549) has the molecular formula C29H56 and a molecular weight of 404.77 g/mol. Its IUPAC name is 5-[4-(3,5-ditert-butyl-4-methylcyclohexyl)butyl]-1,1,3,3-tetramethylcyclohexane.
| Compound Name | 5-[4-(3,5-ditert-butyl-4-methylcyclohexyl)butyl]-1,1,3,3-tetramethylcyclohexane |
|---|---|
| PubChem CID | 58552549 |
| Molecular Formula | C29H56 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.44 |
| IUPAC Name | 5-[4-(3,5-ditert-butyl-4-methylcyclohexyl)butyl]-1,1,3,3-tetramethylcyclohexane |
| SMILES | CC1C(C(C)(C)C)CC(CCCCC2CC(C)(C)CC(C)(C)C2)CC1C(C)(C)C |
| InChI | InChI=1S/C29H56/c1-21-24(26(2,3)4)16-22(17-25(21)27(5,6)7)14-12-13-15-23-18-28(8,9)20-29(10,11)19-23/h21-25H,12-20H2,1-11H3 |
| InChIKey | XKRGKFASYYLHSR-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|