C20H36O — CID 58552768
7-(3,4-dimethylcyclohexyl)-4,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 58552768) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 7-(3,4-dimethylcyclohexyl)-4,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | 7-(3,4-dimethylcyclohexyl)-4,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 58552768 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 7-(3,4-dimethylcyclohexyl)-4,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | CC1CCC(C2CC3CC(O)CC(C)C3CC2C)CC1C |
| InChI | InChI=1S/C20H36O/c1-12-5-6-16(7-13(12)2)20-11-17-10-18(21)8-14(3)19(17)9-15(20)4/h12-21H,5-11H2,1-4H3 |
| InChIKey | IVQVVWYGQWTCBP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |