C23H20Cl2N4O3S — CID 58553163
5-[2-chloro-5-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]-4-oxopentanamide (PubChem CID 58553163) has the molecular formula C23H20Cl2N4O3S and a molecular weight of 503.41 g/mol. Its IUPAC name is 5-[2-chloro-5-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]-4-oxopentanamide.
| Compound Name | 5-[2-chloro-5-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 58553163 |
| Molecular Formula | C23H20Cl2N4O3S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 5-[2-chloro-5-[3-(3-chloro-4-isocyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]-4-oxopentanamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(Cl)c(CC(=O)CCC(N)=O)c3)C2=S)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N4O3S/c1-23(2)21(32)28(14-5-8-19(27-3)18(25)12-14)22(33)29(23)15-4-7-17(24)13(10-15)11-16(30)6-9-20(26)31/h4-5,7-8,10,12H,6,9,11H2,1-2H3,(H2,26,31) |
| InChIKey | MAZHXFWTZPMPCK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|