About 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide
8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide (PubChem CID 58553216) has the molecular formula C18H12ClF2N3O
and a molecular weight of 359.76 g/mol. Its IUPAC name is 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide |
| PubChem CID | 58553216 |
| Molecular Formula | C18H12ClF2N3O |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2cccc(-c3c(F)cc(F)cc3Cl)c2c1 |
| InChI | InChI=1S/C18H12ClF2N3O/c19-14-7-11(20)8-15(21)16(14)12-3-1-2-9-4-5-10(6-13(9)12)17(25)24-18(22)23/h1-8H,(H4,22,23,24,25) |
| InChIKey | VNWMDGKCJMSKOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide?
The IUPAC name of 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide (CID 58553216) is 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide.
What is the SMILES notation for 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide?
The canonical SMILES for 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide is NC(N)=NC(=O)c1ccc2cccc(-c3c(F)cc(F)cc3Cl)c2c1.
What is the InChIKey of 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide?
The InChIKey is VNWMDGKCJMSKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClF2N3O/c19-14-7-11(20)8-15(21)16(14)12-3-1-2-9-4-5-10(6-13(9)12)17(25)24-18(22)23/h1-8H,(H4,22,23,24,25).
What are the key properties of 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide?
8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide has a molecular weight of 359.76 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-chloro-4,6-difluorophenyl)-N-(diaminomethylidene)naphthalene-2-carboxamide is sourced from PubChem (CID 58553216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).