About 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid
8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid (PubChem CID 58553227) has the molecular formula C16H12FNO2S
and a molecular weight of 301.34 g/mol. Its IUPAC name is 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid |
| PubChem CID | 58553227 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid |
| SMILES | Cc1nc(C)c(-c2c(F)ccc3ccc(C(=O)O)cc23)s1 |
| InChI | InChI=1S/C16H12FNO2S/c1-8-15(21-9(2)18-8)14-12-7-11(16(19)20)4-3-10(12)5-6-13(14)17/h3-7H,1-2H3,(H,19,20) |
| InChIKey | GVPDSGSJLIDUKS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid?
The IUPAC name of 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid (CID 58553227) is 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid.
What is the SMILES notation for 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid?
The canonical SMILES for 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid is Cc1nc(C)c(-c2c(F)ccc3ccc(C(=O)O)cc23)s1.
What is the InChIKey of 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid?
The InChIKey is GVPDSGSJLIDUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO2S/c1-8-15(21-9(2)18-8)14-12-7-11(16(19)20)4-3-10(12)5-6-13(14)17/h3-7H,1-2H3,(H,19,20).
What are the key properties of 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid?
8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid has a molecular weight of 301.34 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dimethyl-1,3-thiazol-5-yl)-7-fluoronaphthalene-2-carboxylic acid is sourced from PubChem (CID 58553227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).