(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid

C5H3BCl2FNO2 — CID 58553482

IUPAC(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid
SMILESOB(O)c1c(Cl)cnc(F)c1Cl
InChIInChI=1S/C5H3BCl2FNO2/c7-2-1-10-5(9)4(8)3(2)6(11)12/h1,11-12H
InChIKeyDYCMVBUCUPMWPK-UHFFFAOYSA-N
MW209.80 g/mol
LogP0.21
Rot. Bonds1

About (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid

(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid (PubChem CID 58553482) has the molecular formula C5H3BCl2FNO2 and a molecular weight of 209.80 g/mol. Its IUPAC name is (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid.

Molecular Properties

Compound Name(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid
PubChem CID58553482
Molecular FormulaC5H3BCl2FNO2
Molecular Weight209.80 g/mol
Exact Mass208.96
IUPAC Name(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid
SMILESOB(O)c1c(Cl)cnc(F)c1Cl
InChIInChI=1S/C5H3BCl2FNO2/c7-2-1-10-5(9)4(8)3(2)6(11)12/h1,11-12H
InChIKeyDYCMVBUCUPMWPK-UHFFFAOYSA-N
XLogP0.21
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.80
LogP ≤ 50.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid?
The IUPAC name of (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid (CID 58553482) is (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid.
What is the SMILES notation for (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid?
The canonical SMILES for (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid is OB(O)c1c(Cl)cnc(F)c1Cl.
What is the InChIKey of (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid?
The InChIKey is DYCMVBUCUPMWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BCl2FNO2/c7-2-1-10-5(9)4(8)3(2)6(11)12/h1,11-12H.
What are the key properties of (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid?
(3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid has a molecular weight of 209.80 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichloro-2-fluoro-4-pyridinyl)boronic acid is sourced from PubChem (CID 58553482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).