C14H17NOY-2 — CID 58553900
(2-methanidyl-5-propyl-1,3-dihydroindene-2-carbonyl)azanide;yttrium (PubChem CID 58553900) has the molecular formula C14H17NOY-2 and a molecular weight of 304.20 g/mol. Its IUPAC name is (2-methanidyl-5-propyl-1,3-dihydroindene-2-carbonyl)azanide;yttrium.
| Compound Name | (2-methanidyl-5-propyl-1,3-dihydroindene-2-carbonyl)azanide;yttrium |
|---|---|
| PubChem CID | 58553900 |
| Molecular Formula | C14H17NOY-2 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2-methanidyl-5-propyl-1,3-dihydroindene-2-carbonyl)azanide;yttrium |
| SMILES | [CH2-]C1(C([NH-])=O)Cc2ccc(CCC)cc2C1.[Y] |
| InChI | InChI=1S/C14H18NO.Y/c1-3-4-10-5-6-11-8-14(2,13(15)16)9-12(11)7-10;/h5-7H,2-4,8-9H2,1H3,(H2,15,16);/q-1;/p-1 |
| InChIKey | BAFYATKDMYNVOW-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|