About 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one
3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one (PubChem CID 58553961) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one.
Molecular Properties
| Compound Name | 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one |
| PubChem CID | 58553961 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one |
| SMILES | CCC1=NC2(CCCCCC2)NC1=O |
| InChI | InChI=1S/C11H18N2O/c1-2-9-10(14)13-11(12-9)7-5-3-4-6-8-11/h2-8H2,1H3,(H,13,14) |
| InChIKey | XACOPKSVGWEPFP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one?
The IUPAC name of 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one (CID 58553961) is 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one.
What is the SMILES notation for 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one?
The canonical SMILES for 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one is CCC1=NC2(CCCCCC2)NC1=O.
What is the InChIKey of 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one?
The InChIKey is XACOPKSVGWEPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-2-9-10(14)13-11(12-9)7-5-3-4-6-8-11/h2-8H2,1H3,(H,13,14).
What are the key properties of 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one?
3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one has a molecular weight of 194.28 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,4-diazaspiro[4.6]undec-3-en-2-one is sourced from PubChem (CID 58553961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).