C8H8ClN3O — CID 58554205
5-chloro-6-(2-hydroxyethylamino)pyridine-3-carbonitrile (PubChem CID 58554205) has the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. Its IUPAC name is 5-chloro-6-(2-hydroxyethylamino)pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-(2-hydroxyethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58554205 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 5-chloro-6-(2-hydroxyethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NCCO)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClN3O/c9-7-3-6(4-10)5-12-8(7)11-1-2-13/h3,5,13H,1-2H2,(H,11,12) |
| InChIKey | JSELADUAFLUMBZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |