C22H14F7NO2 — CID 58554519
2-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine (PubChem CID 58554519) has the molecular formula C22H14F7NO2 and a molecular weight of 457.35 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine.
| Compound Name | 2-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 58554519 |
| Molecular Formula | C22H14F7NO2 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine |
| SMILES | Fc1ccc(C2(C(F)(F)c3ccc(-c4ccc(OCC(F)(F)F)cc4)cn3)CO2)c(F)c1 |
| InChI | InChI=1S/C22H14F7NO2/c23-15-4-7-17(18(24)9-15)20(11-32-20)22(28,29)19-8-3-14(10-30-19)13-1-5-16(6-2-13)31-12-21(25,26)27/h1-10H,11-12H2 |
| InChIKey | DJCFJCVZNJEOAT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|