C23H17F4NO — CID 58554524
2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(4-methylphenyl)-2-pyridinyl]pent-4-yn-2-ol (PubChem CID 58554524) has the molecular formula C23H17F4NO and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(4-methylphenyl)-2-pyridinyl]pent-4-yn-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(4-methylphenyl)-2-pyridinyl]pent-4-yn-2-ol |
|---|---|
| PubChem CID | 58554524 |
| Molecular Formula | C23H17F4NO |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[5-(4-methylphenyl)-2-pyridinyl]pent-4-yn-2-ol |
| SMILES | C#CCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C23H17F4NO/c1-3-12-22(29,19-10-9-18(24)13-20(19)25)23(26,27)21-11-8-17(14-28-21)16-6-4-15(2)5-7-16/h1,4-11,13-14,29H,12H2,2H3 |
| InChIKey | UOFJVDCQTNGCPP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|