About [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid
[(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 58554643) has the molecular formula C8H19NO7P2
and a molecular weight of 303.19 g/mol. Its IUPAC name is [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid.
Molecular Properties
| Compound Name | [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid |
| PubChem CID | 58554643 |
| Molecular Formula | C8H19NO7P2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CC(C)(C)C(=O)CN(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H19NO7P2/c1-8(2,3)7(10)4-9(5-17(11,12)13)6-18(14,15)16/h4-6H2,1-3H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | OVYRQZYEKXJHED-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid?
The IUPAC name of [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid (CID 58554643) is [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid.
What is the SMILES notation for [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid?
The canonical SMILES for [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid is CC(C)(C)C(=O)CN(CP(=O)(O)O)CP(=O)(O)O.
What is the InChIKey of [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid?
The InChIKey is OVYRQZYEKXJHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO7P2/c1-8(2,3)7(10)4-9(5-17(11,12)13)6-18(14,15)16/h4-6H2,1-3H3,(H2,11,12,13)(H2,14,15,16).
What are the key properties of [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid?
[(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid has a molecular weight of 303.19 g/mol, XLogP of 0.17, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,3-dimethyl-2-oxobutyl)-(phosphonomethyl)amino]methylphosphonic acid is sourced from PubChem (CID 58554643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).