About 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione
5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione (PubChem CID 58554670) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 58554670 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O3/c1-9(2,3)6(12)5-4-10-8(14)11-7(5)13/h4H,1-3H3,(H2,10,11,13,14) |
| InChIKey | LOBCEPVSKJNWPF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione (CID 58554670) is 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione is CC(C)(C)C(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione?
The InChIKey is LOBCEPVSKJNWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-9(2,3)6(12)5-4-10-8(14)11-7(5)13/h4H,1-3H3,(H2,10,11,13,14).
What are the key properties of 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione?
5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione has a molecular weight of 196.21 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 58554670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).