About 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate
1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 58554708) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| PubChem CID | 58554708 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OCC(C)C |
| InChI | InChI=1S/C18H34O4/c1-8-10-11-21-15(19)17(5,6)13-18(7,9-2)16(20)22-12-14(3)4/h14H,8-13H2,1-7H3 |
| InChIKey | MCIFVJXLQQVQLF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate?
The IUPAC name of 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate (CID 58554708) is 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
What is the SMILES notation for 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate?
The canonical SMILES for 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate is CCCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OCC(C)C.
What is the InChIKey of 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate?
The InChIKey is MCIFVJXLQQVQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-8-10-11-21-15(19)17(5,6)13-18(7,9-2)16(20)22-12-14(3)4/h14H,8-13H2,1-7H3.
What are the key properties of 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate?
1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate has a molecular weight of 314.47 g/mol, XLogP of 4.36, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 5-O-(2-methylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate is sourced from PubChem (CID 58554708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).