About carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium
carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium (PubChem CID 58554792) has the molecular formula C17H36N2Zr-4
and a molecular weight of 359.71 g/mol. Its IUPAC name is carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium.
Molecular Properties
| Compound Name | carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium |
| PubChem CID | 58554792 |
| Molecular Formula | C17H36N2Zr-4 |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium |
| SMILES | C[N-]N(C)C1CCCCC1CC1CCCC1.[CH3-].[CH3-].[CH3-].[Zr] |
| InChI | InChI=1S/C14H27N2.3CH3.Zr/c1-15-16(2)14-10-6-5-9-13(14)11-12-7-3-4-8-12;;;;/h12-14H,3-11H2,1-2H3;3*1H3;/q4*-1; |
| InChIKey | PRBUTJUMFXDZFR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium?
The IUPAC name of carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium (CID 58554792) is carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium.
What is the SMILES notation for carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium?
The canonical SMILES for carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium is C[N-]N(C)C1CCCCC1CC1CCCC1.[CH3-].[CH3-].[CH3-].[Zr].
What is the InChIKey of carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium?
The InChIKey is PRBUTJUMFXDZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2.3CH3.Zr/c1-15-16(2)14-10-6-5-9-13(14)11-12-7-3-4-8-12;;;;/h12-14H,3-11H2,1-2H3;3*1H3;/q4*-1;.
What are the key properties of carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium?
carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium has a molecular weight of 359.71 g/mol, XLogP of 5.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[[2-(cyclopentylmethyl)cyclohexyl]-methylamino]-methylazanide;zirconium is sourced from PubChem (CID 58554792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).