C48H40N4 — CID 58554862
2-[14-(4,5-diphenyl-1H-imidazol-2-yl)-6-tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaenyl]-4,5-diphenyl-2H-imidazole (PubChem CID 58554862) has the molecular formula C48H40N4 and a molecular weight of 672.88 g/mol. Its IUPAC name is 2-[14-(4,5-diphenyl-1H-imidazol-2-yl)-6-tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaenyl]-4,5-diphenyl-2H-imidazole.
| Compound Name | 2-[14-(4,5-diphenyl-1H-imidazol-2-yl)-6-tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaenyl]-4,5-diphenyl-2H-imidazole |
|---|---|
| PubChem CID | 58554862 |
| Molecular Formula | C48H40N4 |
| Molecular Weight | 672.88 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | 2-[14-(4,5-diphenyl-1H-imidazol-2-yl)-6-tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaenyl]-4,5-diphenyl-2H-imidazole |
| SMILES | c1ccc(C2=NC(c3cc4ccc3CCCc3ccc(cc3-c3nc(-c5ccccc5)c(-c5ccccc5)[nH]3)CCC4)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C48H40N4/c1-5-17-37(18-6-1)43-44(38-19-7-2-8-20-38)50-47(49-43)41-31-33-15-13-16-34-28-30-36(26-14-25-35(41)29-27-33)42(32-34)48-51-45(39-21-9-3-10-22-39)46(52-48)40-23-11-4-12-24-40/h1-12,17-24,27-32,47H,13-16,25-26H2,(H,51,52) |
| InChIKey | SBKYRJRWFCJGMY-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.88 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|