C20H20O2 — CID 58554908
tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene-6,14-dicarbaldehyde (PubChem CID 58554908) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene-6,14-dicarbaldehyde.
| Compound Name | tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene-6,14-dicarbaldehyde |
|---|---|
| PubChem CID | 58554908 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene-6,14-dicarbaldehyde |
| SMILES | O=Cc1cc2ccc1CCCc1ccc(cc1C=O)CCC2 |
| InChI | InChI=1S/C20H20O2/c21-13-19-11-15-3-1-4-16-8-10-18(20(12-16)14-22)6-2-5-17(19)9-7-15/h7-14H,1-6H2 |
| InChIKey | DBOQYHAAOPVABA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|