C14H22O — CID 58555255
2,3,3-trimethyl-4-(2-methylphenyl)butan-2-ol (PubChem CID 58555255) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-(2-methylphenyl)butan-2-ol.
| Compound Name | 2,3,3-trimethyl-4-(2-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 58555255 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2,3,3-trimethyl-4-(2-methylphenyl)butan-2-ol |
| SMILES | Cc1ccccc1CC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C14H22O/c1-11-8-6-7-9-12(11)10-13(2,3)14(4,5)15/h6-9,15H,10H2,1-5H3 |
| InChIKey | IYINCVDPCLYGCY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |