C29H48O2 — CID 58555540
[4-(4-ethenylcyclohexyl)cyclohexyl] 4-(3-propylcyclopentyl)cyclohexane-1-carboxylate (PubChem CID 58555540) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is [4-(4-ethenylcyclohexyl)cyclohexyl] 4-(3-propylcyclopentyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-ethenylcyclohexyl)cyclohexyl] 4-(3-propylcyclopentyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58555540 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | [4-(4-ethenylcyclohexyl)cyclohexyl] 4-(3-propylcyclopentyl)cyclohexane-1-carboxylate |
| SMILES | C=CC1CCC(C2CCC(OC(=O)C3CCC(C4CCC(CCC)C4)CC3)CC2)CC1 |
| InChI | InChI=1S/C29H48O2/c1-3-5-22-8-11-27(20-22)25-12-14-26(15-13-25)29(30)31-28-18-16-24(17-19-28)23-9-6-21(4-2)7-10-23/h4,21-28H,2-3,5-20H2,1H3 |
| InChIKey | NJRIACXQKOMYBS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|